Search Results - MIDA

N-Methyliminodiacetic acid

| ChEMBL = 1741474 | ChemSpiderID = 19251 | EC_number = 224-557-6 | PubChem = 20441 | UNII = SH1YP5H4NA | StdInChI=1S/C5H9NO4/c1-6(2-4(7)8)3-5(9)10/h2-3H2,1H3,(H,7,8)(H,9,10) | StdInChIKey = XWSGEVNYFYKXCP-UHFFFAOYSA-N | SMILES = CN(CC(=O)O)CC(=O)O }} |Section2= |Section3= | GHSPictograms = | GHSSignalWord = Warning | HPhrases = | PPhrases = | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''''N''-Methyliminodiacetic acid''' is an organic compound with the formula . It is a white solid, which as its conjugate base is used as a chelating agent for iron. It is a component of organoboron reagents as well. Provided by Wikipedia
  • Showing 1 - 6 results of 6
Refine Results
  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6