Search Results - Dopress

Dosulepin

| pregnancy_AU = C | legal_AU = S4 | routes_of_administration = Oral

| bioavailability = 30% | protein_bound = 84% | metabolism = Hepatic (N-demethylation, S-oxidation, glucuronidation) | metabolites = Northiaden, dothiepin sulfoxide, northiaden sulfoxide, glucuronide conjugates | elimination_half-life = Dothiepin: 14.4–23.9 hours
Dothiepin sulfoxide: 22.7–25.5 hours
Northiaden: 34.7–45.7 hours
Northiaden sulfoxide: 24.2–33.5 hours | excretion = Urine: 56%
Feces: 15%

| index2_label = HCl | CAS_number_Ref = | CAS_number =  113-53-1 | CAS_number2_Ref = | CAS_number2 = 897-15-4 | UNII_Ref = | UNII = W13O82Z7HL | UNII2_Ref = | UNII2 = 3H0042311V | DrugBank = DB09167 | ATC_prefix = N06 | ATC_suffix = AA16 | PubChem = 5284550 | KEGG_Ref = | KEGG = D07872 | ChEBI_Ref = | ChEBI = 36803 | ChEMBL_Ref = | ChEMBL = 108947 | ChemSpiderID_Ref = | ChemSpiderID = 4447605 | synonyms = IZ-914, KS-1596

| C=19 | H=21 | N=1 | S=1 | SMILES = CN(C)CC/C=C/1\C2=CC=CC=C2CSC3=CC=CC=C31 | StdInChI_Ref = | StdInChI = 1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11+ | StdInChIKey_Ref = | StdInChIKey = PHTUQLWOUWZIMZ-GZTJUZNOSA-N }}

Dosulepin, also known as dothiepin and sold under the brand name Prothiaden among others, is a tricyclic antidepressant (TCA) which is used in the treatment of depression. Dosulepin was once the most frequently prescribed antidepressant in the United Kingdom, but it is no longer widely used due to its relatively high toxicity in overdose without therapeutic advantages over other TCAs. It acts as a serotonin–norepinephrine reuptake inhibitor (SNRI) and also has other activities including antihistamine, antiadrenergic, antiserotonergic, anticholinergic, and sodium channel-blocking effects. Provided by Wikipedia